| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[SND]](/icons/sound2.gif) | beatsrsofresh.mp3 | 2007-06-11 20:13 | 90K | |
| ![[SND]](/icons/sound2.gif) | gozer.mp3 | 2007-06-04 12:58 | 415K | |
| ![[SND]](/icons/sound2.gif) | chickenman.mp3 | 2007-05-21 11:54 | 288K | |
| ![[SND]](/icons/sound2.gif) | no1asianbigboobqueen.mp3 | 2007-05-19 13:28 | 48K | |
| ![[SND]](/icons/sound2.gif) | brushyourteeth.mp3 | 2007-05-07 12:04 | 444K | |
| ![[SND]](/icons/sound2.gif) | danteslament.mp3 | 2007-04-09 15:04 | 50K | |
| ![[SND]](/icons/sound2.gif) | yazj.mp3 | 2007-04-02 17:06 | 169K | |
| ![[SND]](/icons/sound2.gif) | mahnamahna.mp3 | 2007-04-02 17:05 | 151K | |
| ![[SND]](/icons/sound2.gif) | gollum-protip.mp3 | 2007-04-02 16:48 | 396K | |
| ![[SND]](/icons/sound2.gif) | jive-protip.mp3 | 2007-04-02 16:46 | 463K | |
| ![[SND]](/icons/sound2.gif) | TMBG Podcast 3A 06.mp3 | 2007-03-19 20:10 | 102K | |
| ![[SND]](/icons/sound2.gif) | doc0-protip-tolerance.mp3 | 2007-02-16 14:37 | 1.5M | |
| ![[SND]](/icons/sound2.gif) | doc0-djshow-ad.mp3 | 2007-02-16 14:36 | 707K | |
| ![[SND]](/icons/sound2.gif) | adama-psa.mp3 | 2007-02-01 18:18 | 370K | |
| ![[SND]](/icons/sound2.gif) | ozzy-psa.mp3 | 2007-02-01 18:07 | 387K | |
| ![[SND]](/icons/sound2.gif) | doyoulikemusic.mp3 | 2007-01-24 13:53 | 548K | |
| ![[SND]](/icons/sound2.gif) | goonjustice.mp3 | 2007-01-10 13:22 | 143K | |
| ![[SND]](/icons/sound2.gif) | protect and survive - radio edit.mp3 | 2007-01-03 18:02 | 628K | |
| ![[SND]](/icons/sound2.gif) | SDB Generic Napster.mp3 | 2006-12-27 16:32 | 130K | |
| ![[SND]](/icons/sound2.gif) | This Station Sucks.mp3 | 2006-12-27 16:05 | 29K | |
| ![[SND]](/icons/sound2.gif) | cashxmas.mp3 | 2006-12-14 13:26 | 346K | |
| ![[SND]](/icons/sound2.gif) | 04 - Johnny Cash - Holiday Message (1994).mp3 | 2006-12-14 11:38 | 346K | |
| ![[SND]](/icons/sound2.gif) | JRNY.mp3 | 2006-12-07 11:50 | 22K | |
| ![[SND]](/icons/sound2.gif) | dalek promo 3.mp3 | 2006-12-07 11:48 | 389K | |
| ![[SND]](/icons/sound2.gif) | 2kxty-Stellllaaaaaa.mp3 | 2006-11-22 23:44 | 304K | |
| ![[SND]](/icons/sound2.gif) | jingle-moneyback.mp3 | 2006-11-04 14:55 | 144K | |
| ![[SND]](/icons/sound2.gif) | jingle-sullivan.mp3 | 2006-11-04 14:54 | 464K | |
| ![[SND]](/icons/sound2.gif) | jingle-leavenow.mp3 | 2006-11-04 14:53 | 269K | |
| ![[SND]](/icons/sound2.gif) | 05 STAGE CLEAR-JINGLE-.mp3 | 2006-10-28 12:43 | 121K | |
| ![[SND]](/icons/sound2.gif) | burgerprotip.mp3 | 2006-10-23 18:03 | 468K | |
| ![[SND]](/icons/sound2.gif) | gbsfmjingle.mp3 | 2006-08-05 16:08 | 167K | |
| ![[SND]](/icons/sound2.gif) | diggerland_kent.mp3 | 2006-06-14 13:24 | 482K | |
| ![[SND]](/icons/sound2.gif) | diggerland_durham.mp3 | 2006-06-14 13:23 | 480K | |
| ![[SND]](/icons/sound2.gif) | diggerland_devon.mp3 | 2006-06-14 13:22 | 479K | |
| ![[SND]](/icons/sound2.gif) | beautifulest.mp3 | 2006-06-06 14:36 | 324K | |
| ![[SND]](/icons/sound2.gif) | TheManko jingle 1.mp3 | 2006-05-31 20:10 | 261K | |
| ![[SND]](/icons/sound2.gif) | Bees (Beatbox Mix).mp3 | 2006-04-30 07:16 | 207K | |
| ![[VID]](/icons/movie.gif) | KF - Shaw bros.mp4 | 2006-04-25 13:38 | 304K | |
| ![[VID]](/icons/movie.gif) | KF - Seasonal film.mp4 | 2006-04-25 13:16 | 278K | |
| ![[VID]](/icons/movie.gif) | KF - Golden Harvest.mp4 | 2006-04-25 13:16 | 347K | |
| ![[SND]](/icons/sound2.gif) | Digtest.ogg | 2006-04-25 13:05 | 34K | |
| ![[SND]](/icons/sound2.gif) | bump1(04).mp3 | 2006-04-22 03:45 | 320K | |
| ![[SND]](/icons/sound2.gif) | Hay!.mp3 | 2006-04-19 22:05 | 248K | |
| ![[SND]](/icons/sound2.gif) | sickentidecanbackmeuponthis.mp3 | 2006-04-14 16:56 | 1.4M | |
| ![[SND]](/icons/sound2.gif) | domstol_ekot.m4a | 2006-04-02 16:05 | 91K | |
| ![[SND]](/icons/sound2.gif) | bringatowel.mp3 | 2006-03-29 20:56 | 204K | |
| ![[SND]](/icons/sound2.gif) | ireallylikegbsfm.mp3 | 2006-03-16 19:05 | 423K | |
| ![[SND]](/icons/sound2.gif) | turnitoff.mp3 | 2006-03-10 04:51 | 456K | |
| ![[SND]](/icons/sound2.gif) | hyperspace.mp3 | 2006-03-09 20:04 | 527K | |
| ![[SND]](/icons/sound2.gif) | Voicemail.mp3 | 2006-03-07 11:42 | 806K | |
| ![[SND]](/icons/sound2.gif) | extra_thumbs jingle.mp3 | 2006-03-06 20:55 | 203K | |
| ![[SND]](/icons/sound2.gif) | hurrprotip_shorter.mp3 | 2006-03-03 13:18 | 483K | |
| ![[SND]](/icons/sound2.gif) | protip_disconnect.mp3 | 2006-03-03 02:41 | 943K | |
| ![[SND]](/icons/sound2.gif) | protip_listeningatwork.mp3 | 2006-03-03 01:24 | 864K | |
| ![[SND]](/icons/sound2.gif) | Billy West - Internet Radio.mp3 | 2006-03-02 20:39 | 774K | |
| ![[SND]](/icons/sound2.gif) | enjoy.mp3 | 2006-02-01 19:31 | 48K | |
| ![[SND]](/icons/sound2.gif) | fyopromo.mp3 | 2006-01-12 09:38 | 588K | |
| ![[SND]](/icons/sound2.gif) | fruity_oaty_bars.mp3 | 2006-01-03 17:14 | 487K | |
| ![[SND]](/icons/sound2.gif) | zoidberg.mp3 | 2005-11-22 16:03 | 88K | |
| ![[SND]](/icons/sound2.gif) | your music, your way, right now.mp3 | 2005-11-22 16:03 | 259K | |
| ![[SND]](/icons/sound2.gif) | wtf2.mp3 | 2005-11-22 16:03 | 158K | |
| ![[SND]](/icons/sound2.gif) | Weekend DJs.mp3 | 2005-11-22 16:03 | 201K | |
| ![[SND]](/icons/sound2.gif) | the ultimate power in the universe.mp3 | 2005-11-22 16:03 | 60K | |
| ![[SND]](/icons/sound2.gif) | THEHALL.mp3 | 2005-11-22 16:03 | 160K | |
| ![[SND]](/icons/sound2.gif) | t Double That Dong.mp3 | 2005-11-22 16:03 | 464K | |
| ![[SND]](/icons/sound2.gif) | synthesis.mp3 | 2005-11-22 16:03 | 62K | |
| ![[SND]](/icons/sound2.gif) | SUPAGRRRL.mp3 | 2005-11-22 16:03 | 169K | |
| ![[SND]](/icons/sound2.gif) | Shoverbot and Pusherbot - GBSFM.mp3 | 2005-11-22 16:03 | 298K | |
| ![[SND]](/icons/sound2.gif) | Psychobabble Promo 1.mp3 | 2005-11-22 16:03 | 315K | |
| ![[SND]](/icons/sound2.gif) | ProTip3.mp3 | 2005-11-22 16:03 | 477K | |
| ![[SND]](/icons/sound2.gif) | promo-radioanarchy.mp3 | 2005-11-22 16:03 | 512K | |
| ![[SND]](/icons/sound2.gif) | ProTip2.mp3 | 2005-11-22 16:03 | 664K | |
| ![[SND]](/icons/sound2.gif) | ProTip1.mp3 | 2005-11-22 16:03 | 680K | |
| ![[SND]](/icons/sound2.gif) | promo-happy pepper-GPF-HotAndSpicy.mp3 | 2005-11-22 16:03 | 388K | |
| ![[SND]](/icons/sound2.gif) | promo-happy pepper (attn whore).mp3 | 2005-11-22 16:03 | 351K | |
| ![[SND]](/icons/sound2.gif) | promo-grim sounds.mp3 | 2005-11-22 16:03 | 376K | |
| ![[SND]](/icons/sound2.gif) | promo-ghetto radio.mp3 | 2005-11-22 16:03 | 682K | |
| ![[SND]](/icons/sound2.gif) | promo-disco phoolcat.mp3 | 2005-11-22 16:03 | 426K | |
| ![[SND]](/icons/sound2.gif) | profmurda-voices.mp3 | 2005-11-22 16:03 | 748K | |
| ![[SND]](/icons/sound2.gif) | pirates.mp3 | 2005-11-22 16:03 | 310K | |
| ![[SND]](/icons/sound2.gif) | Pepper_Promo4GPF_02.mp3 | 2005-11-22 16:03 | 282K | |
| ![[SND]](/icons/sound2.gif) | Pepper_Promo4GPF_01.mp3 | 2005-11-22 16:03 | 263K | |
| ![[SND]](/icons/sound2.gif) | pepper-valley girl.mp3 | 2005-11-22 16:03 | 393K | |
| ![[SND]](/icons/sound2.gif) | pepper-makes me hot.mp3 | 2005-11-22 16:03 | 142K | |
| ![[SND]](/icons/sound2.gif) | pepper-blame GBS.mp3 | 2005-11-22 16:03 | 328K | |
| ![[SND]](/icons/sound2.gif) | Pepper-Sheila2.mp3 | 2005-11-22 16:03 | 279K | |
| ![[SND]](/icons/sound2.gif) | on the air, on the web, continuous music.mp3 | 2005-11-22 16:03 | 170K | |
| ![[SND]](/icons/sound2.gif) | Pepper-25% less monsters.mp3 | 2005-11-22 16:03 | 203K | |
| ![[SND]](/icons/sound2.gif) | mncowmobl1-thisisworse.mp3 | 2005-11-22 16:03 | 211K | |
| ![[SND]](/icons/sound2.gif) | OMG_MUSIC_INSTRU-GBSFMJINGLE.mp3 | 2005-11-22 16:03 | 180K | |
| ![[SND]](/icons/sound2.gif) | NickelSkeletonPromo22.mp3 | 2005-11-22 16:03 | 263K | |
| ![[SND]](/icons/sound2.gif) | mncowmobl1-thisisshit.mp3 | 2005-11-22 16:02 | 162K | |
| ![[SND]](/icons/sound2.gif) | mike promo3.mp3 | 2005-11-22 16:02 | 372K | |
| ![[SND]](/icons/sound2.gif) | mayorwilkins-catchphrases.mp3 | 2005-11-22 16:02 | 433K | |
| ![[SND]](/icons/sound2.gif) | Mayor Wilkins pooper.mp3 | 2005-11-22 16:02 | 962K | |
| ![[SND]](/icons/sound2.gif) | maverick mechanics.mp3 | 2005-11-22 16:02 | 71K | |
| ![[SND]](/icons/sound2.gif) | lich-fyadfyadlol.mp3 | 2005-11-22 16:02 | 37K | |
| ![[SND]](/icons/sound2.gif) | Mayor Wilkins - where you can take a song.mp3 | 2005-11-22 16:02 | 470K | |
| ![[SND]](/icons/sound2.gif) | lich-faggyass.mp3 | 2005-11-22 16:02 | 56K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-phone-clean.mp3 | 2005-11-22 16:02 | 96K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-morons-clean.mp3 | 2005-11-22 16:02 | 32K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-lovingit-clean.mp3 | 2005-11-22 16:02 | 46K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-llama-clean.mp3 | 2005-11-22 16:02 | 49K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-j-lo.mp3 | 2005-11-22 16:02 | 73K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-hasselhoff.mp3 | 2005-11-22 16:02 | 52K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-gbs2-clean.mp3 | 2005-11-22 16:02 | 88K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-gbs-clean.mp3 | 2005-11-22 16:02 | 28K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-decided-clean.mp3 | 2005-11-22 16:02 | 57K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-britishempire.mp3 | 2005-11-22 16:02 | 114K | |
| ![[SND]](/icons/sound2.gif) | lazyjane-bananaphone-clean.mp3 | 2005-11-22 16:02 | 38K | |
| ![[SND]](/icons/sound2.gif) | kuuenbu_scream.mp3 | 2005-11-22 16:02 | 63K | |
| ![[SND]](/icons/sound2.gif) | kuuenbu_qualitymusic.mp3 | 2005-11-22 16:02 | 629K | |
| ![[SND]](/icons/sound2.gif) | kuuenbu_leavethehall.mp3 | 2005-11-22 16:02 | 54K | |
| ![[SND]](/icons/sound2.gif) | kermit-its not easy bing a goon.mp3 | 2005-11-22 16:02 | 718K | |
| ![[SND]](/icons/sound2.gif) | kboo-neko.mp3 | 2005-11-22 16:02 | 86K | |
| ![[SND]](/icons/sound2.gif) | kboo-goons.mp3 | 2005-11-22 16:02 | 202K | |
| ![[SND]](/icons/sound2.gif) | karl-german.mp3 | 2005-11-22 16:02 | 655K | |
| ![[SND]](/icons/sound2.gif) | johnytex-GBS_FM.mp3 | 2005-11-22 16:02 | 377K | |
| ![[SND]](/icons/sound2.gif) | icetraighpromo.mp3 | 2005-11-22 16:02 | 352K | |
| ![[SND]](/icons/sound2.gif) | hoganas-dulyssnartill.mp3 | 2005-11-22 16:02 | 121K | |
| ![[SND]](/icons/sound2.gif) | hildgrim-kalle, balle.mp3 | 2005-11-22 16:02 | 739K | |
| ![[SND]](/icons/sound2.gif) | hawkings.mp3 | 2005-11-22 16:02 | 251K | |
| ![[SND]](/icons/sound2.gif) | Hildgrim.sunny-southern-sweden.mp3 | 2005-11-22 16:02 | 154K | |
| ![[SND]](/icons/sound2.gif) | get_whipped_into_shape-gbsfm.mp3 | 2005-11-22 16:02 | 212K | |
| ![[SND]](/icons/sound2.gif) | Hassel The Hof.mp3 | 2005-11-22 16:02 | 236K | |
| ![[SND]](/icons/sound2.gif) | GR_LL_Proud, is that a typo.mp3 | 2005-11-22 16:02 | 166K | |
| ![[SND]](/icons/sound2.gif) | GBSFM_DJs.mp3 | 2005-11-22 16:02 | 237K | |
| ![[SND]](/icons/sound2.gif) | five golden manbabies to you.mp3 | 2005-11-22 16:02 | 89K | |
| ![[SND]](/icons/sound2.gif) | FunkyMacstrange3.mp3 | 2005-11-22 16:02 | 95K | |
| ![[SND]](/icons/sound2.gif) | FunkyMacstrange2.mp3 | 2005-11-22 16:02 | 89K | |
| ![[SND]](/icons/sound2.gif) | FunkyMacstrange.mp3 | 2005-11-22 16:02 | 138K | |
| ![[SND]](/icons/sound2.gif) | feminism.mp3 | 2005-11-22 16:02 | 939K | |
| ![[SND]](/icons/sound2.gif) | droopy.mp3 | 2005-11-22 16:02 | 68K | |
| ![[SND]](/icons/sound2.gif) | DJ Crakawood - GBS-FM Drop (Hiyah).mp3 | 2005-11-22 16:02 | 126K | |
| ![[SND]](/icons/sound2.gif) | daveexperiment.mp3 | 2005-11-22 16:02 | 482K | |
| ![[SND]](/icons/sound2.gif) | danack-gbsfm.mp3 | 2005-11-22 16:02 | 239K | |
| ![[SND]](/icons/sound2.gif) | broon-instereo.mp3 | 2005-11-22 16:02 | 84K | |
| ![[SND]](/icons/sound2.gif) | Bot Drop 2.mp3 | 2005-11-22 16:02 | 506K | |
| ![[SND]](/icons/sound2.gif) | bimbo.ogg | 2005-11-22 16:02 | 63K | |
| ![[SND]](/icons/sound2.gif) | attmay-jingle-q.mp3 | 2005-11-22 16:02 | 120K | |
| ![[SND]](/icons/sound2.gif) | Bees (Beatbox Mix) (better).mp3 | 2005-11-22 16:02 | 207K | |
| ![[SND]](/icons/sound2.gif) | attmay-jingle-publicdomain.mp3 | 2005-11-22 16:02 | 145K | |
| ![[SND]](/icons/sound2.gif) | attmay-jingle-irc.mp3 | 2005-11-22 16:02 | 215K | |
| ![[SND]](/icons/sound2.gif) | attmay-jingle-fyadam.mp3 | 2005-11-22 16:02 | 275K | |
| ![[SND]](/icons/sound2.gif) | anders-steel hard radio station.mp3 | 2005-11-22 16:02 | 135K | |
| ![[SND]](/icons/sound2.gif) | anders-madonna-b.mp3 | 2005-11-22 16:02 | 422K | |
| ![[SND]](/icons/sound2.gif) | anders-iron age.mp3 | 2005-11-22 16:02 | 102K | |
| ![[SND]](/icons/sound2.gif) | anders-hi there.mp3 | 2005-11-22 16:02 | 132K | |
| ![[SND]](/icons/sound2.gif) | admirald-gbsfmdrop2.mp3 | 2005-11-22 16:02 | 72K | |
| ![[SND]](/icons/sound2.gif) | admirald-gbsfmdrop1.mp3 | 2005-11-22 16:02 | 71K | |
| ![[SND]](/icons/sound2.gif) | _Dead Air_ Promo.mp3 | 2005-11-22 16:02 | 237K | |
| ![[SND]](/icons/sound2.gif) | Absolute_Zero_ID_1.mp3 | 2005-11-22 16:02 | 401K | |
| ![[SND]](/icons/sound2.gif) | 07_power_of_the_power.mp3 | 2005-11-22 16:02 | 0 | |